Showing entry for Licoisoflavone A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0006064 |
| Compound Name | Licoisoflavone A |
| Structure | ![]() |
| Formula | C20H18O6 |
| InchiKey | KCUZCRLRQVRBBV-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=C(O)C(=CC=C1O)C1=COC2=C(C(O)=CC(O)=C2)C1=O |
| Inchi | InChI=1S/C20H18O6/c1-10(2)3-4-13-15(22)6-5-12(19(13)24)14-9-26-17-8-11(21)7-16(23)18(17)20(14)25/h3,5-9,21-24H,4H2,1-2H3 |
| IUPAC | 3-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-4H-chromen-4-one |
| Molecular Weight | 354.36 |
| Pubchem Id | 5281789 |
| Chembl Id | CHEMBL4061300 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4061300 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
