Showing entry for Harmanine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0007015 |
| Compound Name | Harmanine |
| Structure | ![]() |
| Formula | C12H10N2O |
| InchiKey | TYHZEKKOYBCAAL-UHFFFAOYSA-N |
| SMILES | CC1=N(=O)C=CC2=C1NC1=C2C=CC=C1 |
| Inchi | InChI=1S/C12H10N2O/c1-8-12-10(6-7-14(8)15)9-4-2-3-5-11(9)13-12/h2-7,13H,1H3 |
| IUPAC | 1-methyl-9H-2?f?-pyrido[3,4-b]indol-2-one |
| Molecular Weight | 198.22 |
| Pubchem Id | |
| Chembl Id | CHEMBL3401845 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3401845 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
