Showing entry for Hydroxypropanedioic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0007044 |
| Compound Name | Hydroxypropanedioic acid |
| Structure | ![]() |
| Formula | C3H4O5 |
| InchiKey | ROBFUDYVXSDBQM-UHFFFAOYSA-N |
| SMILES | OC(C(O)=O)C(O)=O |
| Inchi | InChI=1S/C3H4O5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6)(H,7,8) |
| IUPAC | 2-hydroxypropanedioic acid |
| Molecular Weight | 120.06 |
| Pubchem Id | 45 |
| Chembl Id | CHEMBL1794676 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50038354 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1794676 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
