Showing entry for 4-Isopropylbenzoic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0007082 |
| Compound Name | 4-Isopropylbenzoic acid |
| Structure | ![]() |
| Formula | C10H12O2 |
| InchiKey | CKMXAIVXVKGGFM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(O)=O |
| Inchi | InChI=1S/C10H12O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3,(H,11,12) |
| IUPAC | 4-(propan-2-yl)benzoic acid |
| Molecular Weight | 164.2 |
| Pubchem Id | 10820 |
| Chembl Id | CHEMBL116158 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | 4IA |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL116158 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
