Showing entry for Licoagrochalcone D
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0007169 |
| Compound Name | Licoagrochalcone D |
| Structure | ![]() |
| Formula | C21H22O5 |
| InchiKey | FMKHMNBODOXQLQ-UXBLZVDNSA-N |
| SMILES | COC1=C(\C=C\C(=O)C2=CC=C(O)C=C2)C=CC2=C1CC(O2)C(C)(C)O |
| Inchi | InChI=1S/C21H22O5/c1-21(2,24)19-12-16-18(26-19)11-7-14(20(16)25-3)6-10-17(23)13-4-8-15(22)9-5-13/h4-11,19,22,24H,12H2,1-3H3/b10-6+ |
| IUPAC | (2E)-1-(4-hydroxyphenyl)-3-[2-(2-hydroxypropan-2-yl)-4-methoxy-2,3-dihydro-1-benzofuran-5-yl]prop-2-en-1-one |
| Molecular Weight | 354.4 |
| Pubchem Id | 5318991 |
| Chembl Id | CHEMBL2437371 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2437371 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
