Showing entry for Mesuagin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0007626 |
| Compound Name | Mesuagin |
| Structure | ![]() |
| Formula | C24H22O5 |
| InchiKey | SVCPILBFQWTZFW-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=C2OC(C)(C)C=CC2=C2OC(=O)C=C(C3=CC=CC=C3)C2=C1O |
| Inchi | InChI=1S/C24H22O5/c1-13(2)20(26)19-21(27)18-16(14-8-6-5-7-9-14)12-17(25)28-22(18)15-10-11-24(3,4)29-23(15)19/h5-13,27H,1-4H3 |
| IUPAC | 5-hydroxy-8,8-dimethyl-6-(2-methylpropanoyl)-4-phenyl-2H,8H-pyrano[2,3-f]chromen-2-one |
| Molecular Weight | 390.43 |
| Pubchem Id | 5319380 |
| Chembl Id | CHEMBL198546 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL198546 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
