Showing entry for Xanthopurpurin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0007746 |
| Compound Name | Xanthopurpurin |
| Structure | ![]() |
| Formula | C14H8O4 |
| InchiKey | WPWWKBNOXTZDQJ-UHFFFAOYSA-N |
| SMILES | OC1=CC2=C(C(O)=C1)C(=O)C1=CC=CC=C1C2=O |
| Inchi | InChI=1S/C14H8O4/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6,15-16H |
| IUPAC | 1,3-dihydroxy-9,10-dihydroanthracene-9,10-dione |
| Molecular Weight | 240.21 |
| Pubchem Id | 196978 |
| Chembl Id | CHEMBL372711 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50400183 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL372711 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
