Showing entry for Noreugenin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0008175 |
| Compound Name | Noreugenin |
| Structure | ![]() |
| Formula | C10H8O4 |
| InchiKey | NCUJRUDLFCGVOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(O1)C=C(O)C=C2O |
| Inchi | InChI=1S/C10H8O4/c1-5-2-7(12)10-8(13)3-6(11)4-9(10)14-5/h2-4,11,13H,1H3 |
| IUPAC | 5,7-dihydroxy-2-methyl-4H-chromen-4-one |
| Molecular Weight | 192.17 |
| Pubchem Id | 5375252 |
| Chembl Id | CHEMBL507707 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL507707 |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
