Showing entry for (-)-Maackiain
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0008179 |
| Compound Name | (-)-Maackiain |
| Structure | ![]() |
| Formula | C16H12O5 |
| InchiKey | HUKSJTUUSUGIDC-UHFFFAOYSA-N |
| SMILES | OC1=CC2=C(C=C1)C1OC3=CC4=C(OCO4)C=C3C1CO2 |
| Inchi | InChI=1S/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2 |
| IUPAC | 5,7,11,19-tetraoxapentacyclo[10.8.0.02,1?.0?,?.013,1?]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol |
| Molecular Weight | 284.26 |
| Pubchem Id | 363863 |
| Chembl Id | CHEMBL239047 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL239047 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
