Showing entry for Licochalcone B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0008711 |
| Compound Name | Licochalcone B |
| Structure | ![]() |
| Formula | C16H14O5 |
| InchiKey | DRDRYGIIYOPBBZ-XBXARRHUSA-N |
| SMILES | COC1=C(\C=C\C(=O)C2=CC=C(O)C=C2)C=CC(O)=C1O |
| Inchi | InChI=1S/C16H14O5/c1-21-16-11(5-9-14(19)15(16)20)4-8-13(18)10-2-6-12(17)7-3-10/h2-9,17,19-20H,1H3/b8-4+ |
| IUPAC | (2E)-3-(3,4-dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| Molecular Weight | 286.28 |
| Pubchem Id | 5318999 |
| Chembl Id | CHEMBL2437372 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2437372 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
