Showing entry for 3',4',5'-Trimethoxytricetin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0009050 |
| Compound Name | 3',4',5'-Trimethoxytricetin |
| Structure | ![]() |
| Formula | C18H16O7 |
| InchiKey | CPCPHNWWTJLXKQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(OC)=C1OC)C1=CC(=O)C2=C(O)C=C(O)C=C2O1 |
| Inchi | InChI=1S/C18H16O7/c1-22-15-4-9(5-16(23-2)18(15)24-3)13-8-12(21)17-11(20)6-10(19)7-14(17)25-13/h4-8,19-20H,1-3H3 |
| IUPAC | 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| Molecular Weight | 344.32 |
| Pubchem Id | 5379265 |
| Chembl Id | CHEMBL486590 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL486590 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
