Showing entry for Lupinisoflavone A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0009372 |
| Compound Name | Lupinisoflavone A |
| Structure | ![]() |
| Formula | C20H16O6 |
| InchiKey | DOGAHANJPKBCGB-UHFFFAOYSA-N |
| SMILES | CC(=C)C1CC2=C(O)C3=C(OC=C(C3=O)C3=C(O)C=C(O)C=C3)C=C2O1 |
| Inchi | InChI=1S/C20H16O6/c1-9(2)15-6-12-16(26-15)7-17-18(19(12)23)20(24)13(8-25-17)11-4-3-10(21)5-14(11)22/h3-5,7-8,15,21-23H,1,6H2,2H3 |
| IUPAC | 6-(2,4-dihydroxyphenyl)-4-hydroxy-2-(prop-1-en-2-yl)-2H,3H,5H-furo[3,2-g]chromen-5-one |
| Molecular Weight | 352.34 |
| Pubchem Id | 5319901 |
| Chembl Id | CHEMBL332078 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL332078 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
