Showing entry for Glycycoumarin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0009455 |
| Compound Name | Glycycoumarin |
| Structure | ![]() |
| Formula | C21H20O6 |
| InchiKey | NZYSZZDSYIBYLC-UHFFFAOYSA-N |
| SMILES | COC1=C(CC=C(C)C)C(O)=CC2=C1C=C(C(=O)O2)C1=C(O)C=C(O)C=C1 |
| Inchi | InChI=1S/C21H20O6/c1-11(2)4-6-14-18(24)10-19-16(20(14)26-3)9-15(21(25)27-19)13-7-5-12(22)8-17(13)23/h4-5,7-10,22-24H,6H2,1-3H3 |
| IUPAC | 3-(2,4-dihydroxyphenyl)-7-hydroxy-5-methoxy-6-(3-methylbut-2-en-1-yl)-2H-chromen-2-one |
| Molecular Weight | 368.38 |
| Pubchem Id | 5317756 |
| Chembl Id | CHEMBL1223642 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50325943 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1223642 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
