Showing entry for Sageone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0009856 |
| Compound Name | Sageone |
| Structure | ![]() |
| Formula | C19H24O3 |
| InchiKey | NPQAMUFQEFLLCY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(O)C(O)=C2C(CCC3=C2C(=O)CCC3(C)C)=C1 |
| Inchi | InChI=1S/C19H24O3/c1-10(2)12-9-11-5-6-13-16(15(11)18(22)17(12)21)14(20)7-8-19(13,3)4/h9-10,21-22H,5-8H2,1-4H3 |
| IUPAC | 5,6-dihydroxy-1,1-dimethyl-7-(propan-2-yl)-1,2,3,4,9,10-hexahydrophenanthren-4-one |
| Molecular Weight | 300.39 |
| Pubchem Id | 6481824 |
| Chembl Id | CHEMBL2376098 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2376098 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
