Showing entry for Gancaonin I
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0009919 |
| Compound Name | Gancaonin I |
| Structure | ![]() |
| Formula | C21H22O5 |
| InchiKey | DKVBYQAVNNRVNN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C(O2)C2=C(O)C=C(O)C=C2)C(OC)=C1CC=C(C)C |
| Inchi | InChI=1S/C21H22O5/c1-12(2)5-7-15-18(24-3)11-20-16(21(15)25-4)10-19(26-20)14-8-6-13(22)9-17(14)23/h5-6,8-11,22-23H,7H2,1-4H3 |
| IUPAC | 4-[4,6-dimethoxy-5-(3-methylbut-2-en-1-yl)-1-benzofuran-2-yl]benzene-1,3-diol |
| Molecular Weight | 354.4 |
| Pubchem Id | 480777 |
| Chembl Id | CHEMBL3808735 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3808735 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
