Showing entry for Batatasin I
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0009942 |
| Compound Name | Batatasin I |
| Structure | ![]() |
| Formula | C17H16O4 |
| InchiKey | KGYHMWVRKYFQQR-UHFFFAOYSA-N |
| SMILES | COC1=CC(OC)=C2C(C=CC3=CC(OC)=C(O)C=C23)=C1 |
| Inchi | InChI=1S/C17H16O4/c1-19-12-6-11-5-4-10-7-15(20-2)14(18)9-13(10)17(11)16(8-12)21-3/h4-9,18H,1-3H3 |
| IUPAC | 2,5,7-trimethoxyphenanthren-3-ol |
| Molecular Weight | 284.31 |
| Pubchem Id | 442694 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 246494 |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
