Showing entry for Isoglycycoumarin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0010028 |
| Compound Name | Isoglycycoumarin |
| Structure | ![]() |
| Formula | C21H20O6 |
| InchiKey | PHHAXWBLJNBVNS-UHFFFAOYSA-N |
| SMILES | COC1=C2C=C(C(=O)OC2=CC2=C1CCC(C)(C)O2)C1=C(O)C=C(O)C=C1 |
| Inchi | InChI=1S/C21H20O6/c1-21(2)7-6-13-18(27-21)10-17-15(19(13)25-3)9-14(20(24)26-17)12-5-4-11(22)8-16(12)23/h4-5,8-10,22-23H,6-7H2,1-3H3 |
| IUPAC | 3-(2,4-dihydroxyphenyl)-5-methoxy-8,8-dimethyl-2H,6H,7H,8H-pyrano[3,2-g]chromen-2-one |
| Molecular Weight | 368.38 |
| Pubchem Id | 14187587 |
| Chembl Id | CHEMBL3809065 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3809065 |
|
|||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
