Showing entry for Rheinanthrone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0010557 |
| Compound Name | Rheinanthrone |
| Structure | ![]() |
| Formula | C15H10O5 |
| InchiKey | OZFQHULMMDWMIV-UHFFFAOYSA-N |
| SMILES | OC(=O)C1=CC(O)=C2C(CC3=C(C(O)=CC=C3)C2=O)=C1 |
| Inchi | InChI=1S/C15H10O5/c16-10-3-1-2-7-4-8-5-9(15(19)20)6-11(17)13(8)14(18)12(7)10/h1-3,5-6,16-17H,4H2,(H,19,20) |
| IUPAC | 4,5-dihydroxy-10-oxo-9,10-dihydroanthracene-2-carboxylic acid |
| Molecular Weight | 270.24 |
| Pubchem Id | 119396 |
| Chembl Id | CHEMBL421615 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL421615 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
