Showing entry for 2,4-Dihydroxychalcone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0010709 |
| Compound Name | 2,4-Dihydroxychalcone |
| Structure | ![]() |
| Formula | C15H12O3 |
| InchiKey | LKNPFZQVNZFLIC-VQHVLOKHSA-N |
| SMILES | OC1=CC(O)=C(\C=C\C(=O)C2=CC=CC=C2)C=C1 |
| Inchi | InChI=1S/C15H12O3/c16-13-8-6-12(15(18)10-13)7-9-14(17)11-4-2-1-3-5-11/h1-10,16,18H/b9-7+ |
| IUPAC | (2E)-3-(2,4-dihydroxyphenyl)-1-phenylprop-2-en-1-one |
| Molecular Weight | 240.25 |
| Pubchem Id | 6433293 |
| Chembl Id | CHEMBL373249 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL373249 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
