Showing entry for Uralenol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0010796 |
| Compound Name | Uralenol |
| Structure | ![]() |
| Formula | C20H18O7 |
| InchiKey | WOMWVGHYSNATOB-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=CC(=CC(O)=C1O)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 |
| Inchi | InChI=1S/C20H18O7/c1-9(2)3-4-10-5-11(6-14(23)17(10)24)20-19(26)18(25)16-13(22)7-12(21)8-15(16)27-20/h3,5-8,21-24,26H,4H2,1-2H3 |
| IUPAC | 2-[3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]-3,5,7-trihydroxy-4H-chromen-4-one |
| Molecular Weight | 370.35 |
| Pubchem Id | 5315126 |
| Chembl Id | CHEMBL113833 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50121024 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL113833 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
