Showing entry for Cyclocommunol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0011158 |
| Compound Name | Cyclocommunol |
| Structure | ![]() |
| Formula | C20H16O6 |
| InchiKey | VHNPAPHWKVLGHG-UHFFFAOYSA-N |
| SMILES | CC(C)=CC1OC2=C(C=CC(O)=C2)C2=C1C(=O)C1=C(O)C=C(O)C=C1O2 |
| Inchi | InChI=1S/C20H16O6/c1-9(2)5-15-18-19(24)17-13(23)6-11(22)8-16(17)26-20(18)12-4-3-10(21)7-14(12)25-15/h3-8,15,21-23H,1-2H3 |
| IUPAC | 1,3,8-trihydroxy-11-(2-methylprop-1-en-1-yl)-11,12-dihydro-5,10-dioxatetraphen-12-one |
| Molecular Weight | 352.34 |
| Pubchem Id | 10315987 |
| Chembl Id | CHEMBL4164003 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4164003 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
