Showing entry for 3',4',5',7,8-Pentamethoxyflavone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0011177 |
| Compound Name | 3',4',5',7,8-Pentamethoxyflavone |
| Structure | ![]() |
| Formula | C20H20O7 |
| InchiKey | IQXUAKMLDBLFJK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(OC)=C1OC)C1=CC(=O)C2=C(O1)C(OC)=C(OC)C=C2 |
| Inchi | InChI=1S/C20H20O7/c1-22-14-7-6-12-13(21)10-15(27-18(12)20(14)26-5)11-8-16(23-2)19(25-4)17(9-11)24-3/h6-10H,1-5H3 |
| IUPAC | 7,8-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| Molecular Weight | 372.37 |
| Pubchem Id | 24750458 |
| Chembl Id | CHEMBL465255 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50025478 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL465255 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
