Showing entry for (E)-4-(3,7-Dimethyl-2,6-octadienyl)-1,3,5-trihydroxyxanthone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0011200 |
| Compound Name | (E)-4-(3,7-Dimethyl-2,6-octadienyl)-1,3,5-trihydroxyxanthone |
| Structure | ![]() |
| Formula | C23H24O5 |
| InchiKey | PCKHKINJZFNYEO-UVTDQMKNSA-N |
| SMILES | CC(C)=CCC\C(C)=C/CC1=C2OC3=C(C=CC=C3O)C(=O)C2=C(O)C=C1O |
| Inchi | InChI=1S/C23H24O5/c1-13(2)6-4-7-14(3)10-11-15-18(25)12-19(26)20-21(27)16-8-5-9-17(24)22(16)28-23(15)20/h5-6,8-10,12,24-26H,4,7,11H2,1-3H3/b14-10- |
| IUPAC | 4-[(2Z)-3,7-dimethylocta-2,6-dien-1-yl]-1,3,5-trihydroxy-9H-xanthen-9-one |
| Molecular Weight | 380.43 |
| Pubchem Id | 44396085 |
| Chembl Id | CHEMBL187247 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50155422 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL187247 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
