Showing entry for 1,4,5-Trihydroxy-3-prenylxanthone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0011203 |
| Compound Name | 1,4,5-Trihydroxy-3-prenylxanthone |
| Structure | ![]() |
| Formula | C18H16O5 |
| InchiKey | BRVVGOBMRRGKCK-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=CC(O)=C2C(=O)C3=C(OC2=C1O)C(O)=CC=C3 |
| Inchi | InChI=1S/C18H16O5/c1-9(2)6-7-10-8-13(20)14-16(22)11-4-3-5-12(19)17(11)23-18(14)15(10)21/h3-6,8,19-21H,7H2,1-2H3 |
| IUPAC | 1,4,5-trihydroxy-3-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Molecular Weight | 312.32 |
| Pubchem Id | 15127377 |
| Chembl Id | CHEMBL188061 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50155430 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL188061 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
