Showing entry for Artonin J
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0011445 |
| Compound Name | Artonin J |
| Structure | ![]() |
| Formula | C25H24O7 |
| InchiKey | WQIPFMCXBWXUAV-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=C(O)C2=C3C(CC4=C2OC2=CC(O)=CC(O)=C2C4=O)C(C)(C)OC3=C1O |
| Inchi | InChI=1S/C25H24O7/c1-10(2)5-6-12-20(28)19-17-14(25(3,4)32-24(17)22(12)30)9-13-21(29)18-15(27)7-11(26)8-16(18)31-23(13)19/h5,7-8,14,26-28,30H,6,9H2,1-4H3 |
| IUPAC | 6,8,17,19-tetrahydroxy-14,14-dimethyl-18-(3-methylbut-2-en-1-yl)-3,15-dioxapentacyclo[11.6.1.02,11.0?,?.01?,2?]icosa-1(20),2(11),4,6,8,16,18-heptaen-10-one |
| Molecular Weight | 436.45 |
| Pubchem Id | 44258663 |
| Chembl Id | CHEMBL4165611 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4165611 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
