Showing entry for Agrocybenine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0012127 |
| Compound Name | Agrocybenine |
| Structure | ![]() |
| Formula | C12H18N2O |
| InchiKey | OTBGQBSPIWKINO-UHFFFAOYSA-N |
| SMILES | CC1=C2NC(C)(C)CC2=NC(C)(C)C1=O |
| Inchi | InChI=1S/C12H18N2O/c1-7-9-8(6-11(2,3)14-9)13-12(4,5)10(7)15/h14H,6H2,1-5H3 |
| IUPAC | 2,2,5,5,7-pentamethyl-1H,2H,3H,5H,6H-pyrrolo[3,2-b]pyridin-6-one |
| Molecular Weight | 206.28 |
| Pubchem Id | 23278458 |
| Chembl Id | CHEMBL4166595 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4166595 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
