Showing entry for 20R,24S-Epoxy-25-hydroxy-A-homo-4-oxadammaran-3-one
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0012637 |
| Compound Name | 20R,24S-Epoxy-25-hydroxy-A-homo-4-oxadammaran-3-one |
| Structure | ![]() |
| Formula | C30H50O4 |
| InchiKey | ZHWDSUNHEWADAB-UJTCPHDRSA-N |
| SMILES | O=C1CC[C@]2([C@H](C(O1)(C)C)CC[C@@]1([C@@H]2CC[C@H]2[C@@]1(C)CC[C@@H]2[C@@]1(C)CC[C@H](O1)C(O)(C)C)C)C |
| Inchi | InChI=1S/C30H50O4/c1-25(2,32)23-13-18-30(8,33-23)20-11-16-28(6)19(20)9-10-22-27(5)15-14-24(31)34-26(3,4)21(27)12-17-29(22,28)7/h19-23,32H,9-18H2,1-8H3/t19-,20+,21+,22-,23+,27+,28-,29-,30-/m1/s1 |
| IUPAC | |
| Molecular Weight | 474.37 |
| Pubchem Id | 53323547 |
| Chembl Id | CHEMBL1651033 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50335580 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1651033 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
