Showing entry for 1-(2-Methylpropanoyl)-Phloroglucinol-Glucopyranoside
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013160 |
| Compound Name | 1-(2-Methylpropanoyl)-Phloroglucinol-Glucopyranoside |
| Structure | ![]() |
| Formula | C16H22O9 |
| InchiKey | PSBKCHXAPMSDFN-LMXXTMHSSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc(c2C(=O)C(C)C)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C16H22O9/c1-6(2)12(20)11-8(19)3-7(18)4-9(11)24-16-15(23)14(22)13(21)10(5-17)25-16/h3-4,6,10,13-19,21-23H,5H2,1-2H3/t10-,13-,14+,15-,16-/m1/s1 |
| IUPAC | 1-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2-methylpropan-1-one |
| Molecular Weight | 358.13 |
| Pubchem Id | 11566620 |
| Chembl Id | CHEMBL456751 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50269661 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL456751 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
