Showing entry for Baicalein Trimethyl Ether
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013223 |
| Compound Name | Baicalein Trimethyl Ether |
| Structure | ![]() |
| Formula | C18H16O5 |
| InchiKey | HJNJAUYFFFOFBW-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(cc(=O)c2c(c1OC)OC)c1ccccc1 |
| Inchi | InChI=1S/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| IUPAC | 5,6,7-trimethoxy-2-phenylchromen-4-one |
| Molecular Weight | 312.1 |
| Pubchem Id | 442583 |
| Chembl Id | CHEMBL182992 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL182992 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
