Showing entry for Sigmoidin B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013286 |
| Compound Name | Sigmoidin B |
| Structure | ![]() |
| Formula | C20H20O6 |
| InchiKey | SFQIGPZCFNTPOD-KRWDZBQOSA-N |
| SMILES | CC(=CCc1cc(cc(c1O)O)[C@@H]1CC(=O)c2c(O1)cc(cc2O)O)C |
| Inchi | InChI=1S/C20H20O6/c1-10(2)3-4-11-5-12(6-16(24)20(11)25)17-9-15(23)19-14(22)7-13(21)8-18(19)26-17/h3,5-8,17,21-22,24-25H,4,9H2,1-2H3/t17-/m0/s1 |
| IUPAC | (2S)-2-[3,4-dihydroxy-5-(3-methylbut-2-enyl)phenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| Molecular Weight | 356.13 |
| Pubchem Id | 73205 |
| Chembl Id | CHEMBL229454 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | 50212399 |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL229454 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
