Showing entry for Nelumal A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013500 |
| Compound Name | Nelumal A |
| Structure | ![]() |
| Formula | C21H28O4 |
| InchiKey | YXLSEBZIZVYKKV-NRHDHWSESA-N |
| SMILES | O=C/C=C/c1cc(OC)c(c(c1)OC)OC/C=C(/CCC=C(C)C)\C |
| Inchi | InChI=1S/C21H28O4/c1-16(2)8-6-9-17(3)11-13-25-21-19(23-4)14-18(10-7-12-22)15-20(21)24-5/h7-8,10-12,14-15H,6,9,13H2,1-5H3/b10-7+,17-11+ |
| IUPAC | (E)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,5-dimethoxyphenyl]prop-2-enal |
| Molecular Weight | 344.2 |
| Pubchem Id | 11175348 |
| Chembl Id | CHEMBL464705 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL464705 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
