Showing entry for 5-Hydroxy-3,6,7-Trimethoxy-2-(4-Methoxyphenyl)Chromen-4-One
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013704 |
| Compound Name | 5-Hydroxy-3,6,7-Trimethoxy-2-(4-Methoxyphenyl)Chromen-4-One |
| Structure | ![]() |
| Formula | C19H18O7 |
| InchiKey | ADNCDMHZHONBRR-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)c1oc2cc(OC)c(c(c2c(=O)c1OC)O)OC |
| Inchi | InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)17-19(25-4)16(21)14-12(26-17)9-13(23-2)18(24-3)15(14)20/h5-9,20H,1-4H3 |
| IUPAC | 5-hydroxy-3,6,7-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| Molecular Weight | 358.11 |
| Pubchem Id | 5318355 |
| Chembl Id | CHEMBL521934 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL521934 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
