Showing entry for 2-OXOALANTOLACTONE
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013744 |
| Compound Name | 2-OXOALANTOLACTONE |
| Structure | ![]() |
| Formula | C15H18O3 |
| InchiKey | DSTJGYCTYZXZNH-DGFVYPATSA-N |
| SMILES | O=C1C[C@H](C)C2=C[C@H]3[C@@H](C[C@]2(C1)C)OC(=O)C3=C |
| Inchi | InChI=1S/C15H18O3/c1-8-4-10(16)6-15(3)7-13-11(5-12(8)15)9(2)14(17)18-13/h5,8,11,13H,2,4,6-7H2,1,3H3/t8-,11+,13+,15+/m0/s1 |
| IUPAC | (3aR,5S,8aS,9aR)-5,8a-dimethyl-3-methylidene-3a,5,6,8,9,9a-hexahydrobenzo[f][1]benzofuran-2,7-dione |
| Molecular Weight | 246.13 |
| Pubchem Id | 73356469 |
| Chembl Id | CHEMBL2380793 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50433444 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2380793 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
