Showing entry for licochalcone G
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013769 |
| Compound Name | licochalcone G |
| Structure | ![]() |
| Formula | C21H22O5 |
| InchiKey | UYRRMZSSCNIGNC-RMKNXTFCSA-N |
| SMILES | C=CC(c1cc(/C=C/C(=O)c2ccc(cc2O)O)c(cc1O)OC)(C)C |
| Inchi | InChI=1S/C21H22O5/c1-5-21(2,3)16-10-13(20(26-4)12-19(16)25)6-9-17(23)15-8-7-14(22)11-18(15)24/h5-12,22,24-25H,1H2,2-4H3/b9-6+ |
| IUPAC | (E)-1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-2-methoxy-5-(2-methylbut-3-en-2-yl)phenyl]prop-2-en-1-one |
| Molecular Weight | 354.15 |
| Pubchem Id | 49856081 |
| Chembl Id | CHEMBL1644931 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1644931 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
