Showing entry for (E)-3-Hydroxy-5,6-dihydro-beta-ionone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013821 |
| Compound Name | (E)-3-Hydroxy-5,6-dihydro-beta-ionone |
| Structure | ![]() |
| Formula | C13H22O2 |
| InchiKey | FEQPLOLFLKUQNO-KQKLDACOSA-N |
| SMILES | O[C@H]1C[C@@H](C)[C@@H](C(C1)(C)C)/C=C/C(=O)C |
| Inchi | InChI=1S/C13H22O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h5-6,9,11-12,15H,7-8H2,1-4H3/b6-5+/t9-,11+,12+/m1/s1 |
| IUPAC | (E)-4-[(1R,4S,6R)-4-hydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one |
| Molecular Weight | 210.16 |
| Pubchem Id | 21630918 |
| Chembl Id | CHEMBL2392479 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2392479 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
