Showing entry for crinine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013927 |
| Compound Name | crinine |
| Structure | ![]() |
| Formula | C16H17NO3 |
| InchiKey | RPAORVSEYNOMBR-IUIKQTSFSA-N |
| SMILES | O[C@H]1C=C[C@@]23[C@@H](C1)N(CC2)Cc1c3cc2OCOc2c1 |
| Inchi | InChI=1S/C16H17NO3/c18-11-1-2-16-3-4-17(15(16)6-11)8-10-5-13-14(7-12(10)16)20-9-19-13/h1-2,5,7,11,15,18H,3-4,6,8-9H2/t11-,15+,16+/m0/s1 |
| IUPAC | |
| Molecular Weight | 271.12 |
| Pubchem Id | 398937 |
| Chembl Id | CHEMBL1221864 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1221864 |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
