Showing entry for huperzinine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013948 |
| Compound Name | huperzinine |
| Structure | ![]() |
| Formula | C17H22N2O |
| InchiKey | GDGWMBXSNPMXBY-OGHNNQOOSA-N |
| SMILES | C=C[C@@H]1[C@H]2C=C(C[C@]1(N(C)C)c1c(C2)nc(cc1)O)C |
| Inchi | InChI=1S/C17H22N2O/c1-5-13-12-8-11(2)10-17(13,19(3)4)14-6-7-16(20)18-15(14)9-12/h5-8,12-13H,1,9-10H2,2-4H3,(H,18,20)/t12-,13+,17+/m0/s1 |
| IUPAC | |
| Molecular Weight | 270.17 |
| Pubchem Id | 195296 |
| Chembl Id | CHEMBL470349 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL470349 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
