Showing entry for 5-deoxyinositol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013971 |
| Compound Name | 5-deoxyinositol |
| Structure | ![]() |
| Formula | C6H12O5 |
| InchiKey | IMPKVMRTXBRHRB-MBMOQRBOSA-N |
| SMILES | O[C@@H]1C[C@@H](O)[C@@H](C([C@H]1O)O)O |
| Inchi | InChI=1S/C6H12O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2-11H,1H2/t2-,3-,4+,5+/m1/s1 |
| IUPAC | (1R,2S,4S,5R)-cyclohexane-1,2,3,4,5-pentol |
| Molecular Weight | 164.07 |
| Pubchem Id | 441437 |
| Chembl Id | CHEMBL1950778 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | HQ8 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1950778 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
