Showing entry for 2,6-Dimethoxyhydroquinone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014424 |
| Compound Name | 2,6-Dimethoxyhydroquinone |
| Structure | ![]() |
| Formula | C8H10O4 |
| InchiKey | GXAVBFNRWXCOPY-UHFFFAOYSA-N |
| SMILES | COc1cc(O)cc(c1O)OC |
| Inchi | InChI=1S/C8H10O4/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4,9-10H,1-2H3 |
| IUPAC | 2,6-dimethoxybenzene-1,4-diol |
| Molecular Weight | 170.06 |
| Pubchem Id | 96038 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | KIB |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
