Showing entry for Oil, [cashew]
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014439 |
| Compound Name | Oil, [cashew] |
| Structure | ![]() |
| Formula | C22H32O3 |
| InchiKey | KAOMOVYHGLSFHQ-AOSYACOCSA-N |
| SMILES | CCC/C=C/C/C=C/CCCCCCCc1cccc(c1C(=O)O)O |
| Inchi | InChI=1S/C22H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h4-5,7-8,15,17-18,23H,2-3,6,9-14,16H2,1H3,(H,24,25)/b5-4+,8-7+ |
| IUPAC | 2-hydroxy-6-[(8E,11E)-pentadeca-8,11-dienyl]benzoic acid |
| Molecular Weight | 344.24 |
| Pubchem Id | 9833719 |
| Chembl Id | CHEMBL465536 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||
| Binding DB | 50248617 |
|
|||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL465536 |
|
|||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
