Showing entry for Artanomalide B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014468 |
| Compound Name | Artanomalide B |
| Structure | ![]() |
| Formula | C15H19ClO5 |
| InchiKey | LSJACVRYYGZXIP-CJGKHJOQSA-N |
| SMILES | O=C1O[C@H]2[C@H](C1=C)CC[C@]([C@]13[C@@H]2[C@@](C)(O)[C@H]([C@@H]3O1)Cl)(C)O |
| Inchi | InChI=1S/C15H19ClO5/c1-6-7-4-5-13(2,18)15-9(8(7)20-12(6)17)14(3,19)10(16)11(15)21-15/h7-11,18-19H,1,4-5H2,2-3H3/t7-,8-,9-,10-,11-,13-,14+,15+/m0/s1 |
| IUPAC | |
| Molecular Weight | 314.09 |
| Pubchem Id | 44627810 |
| Chembl Id | CHEMBL1087258 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1087258 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
