Showing entry for 3,3'-Dihydroxy-4',5-Dimethoxybibenzyl
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014690 |
| Compound Name | 3,3'-Dihydroxy-4',5-Dimethoxybibenzyl |
| Structure | ![]() |
| Formula | C16H18O4 |
| InchiKey | SDXKZPQOVUDXIY-UHFFFAOYSA-N |
| SMILES | COc1cc(CCc2ccc(c(c2)O)OC)cc(c1)O |
| Inchi | InChI=1S/C16H18O4/c1-19-14-8-12(7-13(17)10-14)4-3-11-5-6-16(20-2)15(18)9-11/h5-10,17-18H,3-4H2,1-2H3 |
| IUPAC | 5-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol |
| Molecular Weight | 274.12 |
| Pubchem Id | 3085362 |
| Chembl Id | CHEMBL426871 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL426871 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
