Showing entry for Gigantol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014733 |
| Compound Name | Gigantol |
| Structure | ![]() |
| Formula | C16H18O4 |
| InchiKey | BMSPEISBKGSBTR-UHFFFAOYSA-N |
| SMILES | COc1cc(CCc2ccc(c(c2)OC)O)cc(c1)O |
| Inchi | InChI=1S/C16H18O4/c1-19-14-8-12(7-13(17)10-14)4-3-11-5-6-15(18)16(9-11)20-2/h5-10,17-18H,3-4H2,1-2H3 |
| IUPAC | 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol |
| Molecular Weight | 274.12 |
| Pubchem Id | 10221179 |
| Chembl Id | CHEMBL219553 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50346823 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL219553 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
