Showing entry for latilagascene F
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014762 |
| Compound Name | latilagascene F |
| Structure | ![]() |
| Formula | C27H34O5 |
| InchiKey | PUMUUUQEIUDTCS-WMBVEYRISA-N |
| SMILES | C[C@H]1C[C@]2([C@H]([C@H]1O)[C@H]1O[C@]1(C)CC[C@H]1[C@@H](/C=C(/C2=O)\C)C1(C)C)OC(=O)c1ccccc1 |
| Inchi | InChI=1S/C27H34O5/c1-15-13-19-18(25(19,3)4)11-12-26(5)23(31-26)20-21(28)16(2)14-27(20,22(15)29)32-24(30)17-9-7-6-8-10-17/h6-10,13,16,18-21,23,28H,11-12,14H2,1-5H3/b15-13+/t16-,18-,19+,20+,21-,23+,26+,27+/m0/s1 |
| IUPAC | |
| Molecular Weight | 438.24 |
| Pubchem Id | 44588922 |
| Chembl Id | CHEMBL519354 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL519354 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
