Showing entry for Usimine B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014804 |
| Compound Name | Usimine B |
| Structure | ![]() |
| Formula | C23H23NO10 |
| InchiKey | WFFMTGCIAAQCKO-YBIMWRBWSA-N |
| SMILES | OC(=O)CC[C@@H](C(=O)O)/N=C(/C1=C(O)C=C2[C@@](C1=O)(C)c1c(O)c(C)c(c(c1O2)C(=O)C)O)\C |
| Inchi | InChI=1S/C23H23NO10/c1-8-18(29)16(10(3)25)20-17(19(8)30)23(4)13(34-20)7-12(26)15(21(23)31)9(2)24-11(22(32)33)5-6-14(27)28/h7,11,26,29-30H,5-6H2,1-4H3,(H,27,28)(H,32,33)/b24-9+/t11-,23-/m0/s1 |
| IUPAC | |
| Molecular Weight | 473.13 |
| Pubchem Id | |
| Chembl Id | CHEMBL514578 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL514578 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
