Showing entry for (+)-Hydroxy-alpha-ionone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014822 |
| Compound Name | (+)-Hydroxy-alpha-ionone |
| Structure | ![]() |
| Formula | C13H20O2 |
| InchiKey | FDSNVAKZRJLMJN-WTIVYXKASA-N |
| SMILES | CC(=O)/C=C/[C@H]1C(=C[C@@H](CC1(C)C)O)C |
| Inchi | InChI=1S/C13H20O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h5-7,11-12,15H,8H2,1-4H3/b6-5+/t11-,12-/m0/s1 |
| IUPAC | |
| Molecular Weight | 208.15 |
| Pubchem Id | 10889124 |
| Chembl Id | CHEMBL458125 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL458125 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
