Showing entry for methyl aristolate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014901 |
| Compound Name | methyl aristolate |
| Structure | ![]() |
| Formula | C18H14O5 |
| InchiKey | LBBQPQFZUZOHTO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2OCOc2c2c1ccc1c2cccc1OC |
| Inchi | InChI=1S/C18H14O5/c1-20-14-5-3-4-11-10(14)6-7-12-13(18(19)21-2)8-15-17(16(11)12)23-9-22-15/h3-8H,9H2,1-2H3 |
| IUPAC | methyl 8-methoxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylate |
| Molecular Weight | 310.08 |
| Pubchem Id | 160246 |
| Chembl Id | CHEMBL520680 |
| Targets of Information Source | ||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||
| CHEMBL | CHEMBL520680 |
|
||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
