Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014913 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C28H42O6 |
| InchiKey | QWEBGLOUXCMOMA-WDXCJRAPSA-N |
| SMILES | CCCCCC(=O)O[C@H]1[C@@H](C)C[C@]2([C@H]1/C=C(\CO)/CC[C@H]1[C@@H](/C=C(/C2=O)\C)C1(C)C)OC(=O)C |
| Inchi | InChI=1S/C28H42O6/c1-7-8-9-10-24(31)33-25-18(3)15-28(34-19(4)30)23(25)14-20(16-29)11-12-21-22(27(21,5)6)13-17(2)26(28)32/h13-14,18,21-23,25,29H,7-12,15-16H2,1-6H3/b17-13+,20-14-/t18-,21-,22+,23-,25-,28+/m0/s1 |
| IUPAC | |
| Molecular Weight | 474.3 |
| Pubchem Id | 11754671 |
| Chembl Id | CHEMBL518541 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL518541 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
