Showing entry for Hyphenrone C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015291 |
| Compound Name | Hyphenrone C |
| Structure | ![]() |
| Formula | C32H44O5 |
| InchiKey | AEVDRGYEHJFKLT-UXSGCWECSA-N |
| SMILES | O=CC1=C(C(C)C)[C@H]2[C@@](C1)(C)[C@@H](CC=C(C)C)C[C@@]1(C(=O)[C@@](C2=O)(CC=C(C)C)OC1=O)CC=C(C)C |
| Inchi | InChI=1S/C32H44O5/c1-19(2)10-11-24-17-31(14-12-20(3)4)28(35)32(37-29(31)36,15-13-21(5)6)27(34)26-25(22(7)8)23(18-33)16-30(24,26)9/h10,12-13,18,22,24,26H,11,14-17H2,1-9H3/t24-,26+,30+,31+,32-/m0/s1 |
| IUPAC | |
| Molecular Weight | 508.32 |
| Pubchem Id | 102129928 |
| Chembl Id | CHEMBL3581582 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3581582 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
