Showing entry for Aristolochic Acid Iii
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015350 |
| Compound Name | Aristolochic Acid Iii |
| Structure | ![]() |
| Formula | C16H9NO7 |
| InchiKey | LGZIKBZSCRORQN-UHFFFAOYSA-N |
| SMILES | O=N(=O)c1cc2c(O)cccc2c2c1c(cc1c2OCO1)C(=O)O |
| Inchi | InChI=1S/C16H9NO7/c18-11-3-1-2-7-8(11)4-10(17(21)22)13-9(16(19)20)5-12-15(14(7)13)24-6-23-12/h1-5,18H,6H2,(H,19,20) |
| IUPAC | 8-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
| Molecular Weight | 327.04 |
| Pubchem Id | 148297 |
| Chembl Id | CHEMBL601026 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50306861 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL601026 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
